C19H23BrF4N2O4 — CID 156748226
4-[1-(6-bromo-3-fluoro-2-pyridinyl)-3,3-dimethylbutyl]-2-(trifluoromethyl)piperidine-1,4-dicarboxylic acid (PubChem CID 156748226) has the molecular formula C19H23BrF4N2O4 and a molecular weight of 499.30 g/mol. Its IUPAC name is 4-[1-(6-bromo-3-fluoro-2-pyridinyl)-3,3-dimethylbutyl]-2-(trifluoromethyl)piperidine-1,4-dicarboxylic acid.
| Compound Name | 4-[1-(6-bromo-3-fluoro-2-pyridinyl)-3,3-dimethylbutyl]-2-(trifluoromethyl)piperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 156748226 |
| Molecular Formula | C19H23BrF4N2O4 |
| Molecular Weight | 499.30 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 4-[1-(6-bromo-3-fluoro-2-pyridinyl)-3,3-dimethylbutyl]-2-(trifluoromethyl)piperidine-1,4-dicarboxylic acid |
| SMILES | CC(C)(C)CC(c1nc(Br)ccc1F)C1(C(=O)O)CCN(C(=O)O)C(C(F)(F)F)C1 |
| InChI | InChI=1S/C19H23BrF4N2O4/c1-17(2,3)8-10(14-11(21)4-5-13(20)25-14)18(15(27)28)6-7-26(16(29)30)12(9-18)19(22,23)24/h4-5,10,12H,6-9H2,1-3H3,(H,27,28)(H,29,30) |
| InChIKey | NHTWPCGHDBOMNM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.30 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|