C26H43N3O6 — CID 156748352
tert-butyl (2S)-3-[4-[(2S)-2-hydroxy-4-(3-methoxypropyl)piperazin-1-yl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 156748352) has the molecular formula C26H43N3O6 and a molecular weight of 493.65 g/mol. Its IUPAC name is tert-butyl (2S)-3-[4-[(2S)-2-hydroxy-4-(3-methoxypropyl)piperazin-1-yl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-[4-[(2S)-2-hydroxy-4-(3-methoxypropyl)piperazin-1-yl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 156748352 |
| Molecular Formula | C26H43N3O6 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | tert-butyl (2S)-3-[4-[(2S)-2-hydroxy-4-(3-methoxypropyl)piperazin-1-yl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COCCCN1CCN(c2ccc(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc2)[C@@H](O)C1 |
| InChI | InChI=1S/C26H43N3O6/c1-25(2,3)34-23(31)21(27-24(32)35-26(4,5)6)17-19-9-11-20(12-10-19)29-15-14-28(18-22(29)30)13-8-16-33-7/h9-12,21-22,30H,8,13-18H2,1-7H3,(H,27,32)/t21-,22-/m0/s1 |
| InChIKey | YVUQLSZGMJKZRL-VXKWHMMOSA-N |
| XLogP | 2.94 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|