C13H12N5O2+ — CID 156748765
3-[4-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)pyridin-1-ium-1-yl]propanoic acid (PubChem CID 156748765) has the molecular formula C13H12N5O2+ and a molecular weight of 270.27 g/mol. Its IUPAC name is 3-[4-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)pyridin-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[4-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)pyridin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 156748765 |
| Molecular Formula | C13H12N5O2+ |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-[4-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)pyridin-1-ium-1-yl]propanoic acid |
| SMILES | O=C(O)CC[n+]1ccc(-c2nc3ncccn3n2)cc1 |
| InChI | InChI=1S/C13H11N5O2/c19-11(20)4-9-17-7-2-10(3-8-17)12-15-13-14-5-1-6-18(13)16-12/h1-3,5-8H,4,9H2/p+1 |
| InChIKey | IDRXVVGLNCGYIW-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 84.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|