About N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen
N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen (PubChem CID 156748932) has the molecular formula C11H21F2N
and a molecular weight of 205.29 g/mol. Its IUPAC name is N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen.
Molecular Properties
| Compound Name | N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen |
| PubChem CID | 156748932 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen |
| SMILES | CCCNCC1CC2(C1)CC(F)(F)C2.[H][H] |
| InChI | InChI=1S/C11H19F2N.H2/c1-2-3-14-6-9-4-10(5-9)7-11(12,13)8-10;/h9,14H,2-8H2,1H3;1H |
| InChIKey | JHTNGXLFTKCGRZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen?
The IUPAC name of N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen (CID 156748932) is N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen.
What is the SMILES notation for N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen?
The canonical SMILES for N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen is CCCNCC1CC2(C1)CC(F)(F)C2.[H][H].
What is the InChIKey of N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen?
The InChIKey is JHTNGXLFTKCGRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2N.H2/c1-2-3-14-6-9-4-10(5-9)7-11(12,13)8-10;/h9,14H,2-8H2,1H3;1H.
What are the key properties of N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen?
N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen has a molecular weight of 205.29 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,2-difluorospiro[3.3]heptan-6-yl)methyl]propan-1-amine;molecular hydrogen is sourced from PubChem (CID 156748932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).