C23H24F3N5O3 — CID 156749270
12-(difluoromethyl)-13-[[5-fluoro-2-[[1-(methylaminomethyl)cyclopropyl]methoxy]phenyl]methyl]-10-oxa-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carbaldehyde (PubChem CID 156749270) has the molecular formula C23H24F3N5O3 and a molecular weight of 475.47 g/mol. Its IUPAC name is 12-(difluoromethyl)-13-[[5-fluoro-2-[[1-(methylaminomethyl)cyclopropyl]methoxy]phenyl]methyl]-10-oxa-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carbaldehyde.
| Compound Name | 12-(difluoromethyl)-13-[[5-fluoro-2-[[1-(methylaminomethyl)cyclopropyl]methoxy]phenyl]methyl]-10-oxa-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carbaldehyde |
|---|---|
| PubChem CID | 156749270 |
| Molecular Formula | C23H24F3N5O3 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 12-(difluoromethyl)-13-[[5-fluoro-2-[[1-(methylaminomethyl)cyclopropyl]methoxy]phenyl]methyl]-10-oxa-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carbaldehyde |
| SMILES | CNCC1(COc2ccc(F)cc2CN2c3nc4c(C=O)cnn4cc3OCC2C(F)F)CC1 |
| InChI | InChI=1S/C23H24F3N5O3/c1-27-12-23(4-5-23)13-34-18-3-2-16(24)6-14(18)8-30-17(20(25)26)11-33-19-9-31-21(29-22(19)30)15(10-32)7-28-31/h2-3,6-7,9-10,17,20,27H,4-5,8,11-13H2,1H3 |
| InChIKey | RYUXVZGYAVEYHZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|