C14H25N2O5P — CID 156749346
methoxy-[4-(2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl)cyclohexyl]phosphinic acid (PubChem CID 156749346) has the molecular formula C14H25N2O5P and a molecular weight of 332.34 g/mol. Its IUPAC name is methoxy-[4-(2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl)cyclohexyl]phosphinic acid.
| Compound Name | methoxy-[4-(2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl)cyclohexyl]phosphinic acid |
|---|---|
| PubChem CID | 156749346 |
| Molecular Formula | C14H25N2O5P |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | methoxy-[4-(2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-3-yl)cyclohexyl]phosphinic acid |
| SMILES | COP(=O)(O)C1CCC(N2CC3(CCNCC3)OC2=O)CC1 |
| InChI | InChI=1S/C14H25N2O5P/c1-20-22(18,19)12-4-2-11(3-5-12)16-10-14(21-13(16)17)6-8-15-9-7-14/h11-12,15H,2-10H2,1H3,(H,18,19) |
| InChIKey | FGQRAOVXBDDBQE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|