C18H27F2NO2 — CID 156749688
tert-butyl 3,3-difluoro-2-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine-1-carboxylate (PubChem CID 156749688) has the molecular formula C18H27F2NO2 and a molecular weight of 327.42 g/mol. Its IUPAC name is tert-butyl 3,3-difluoro-2-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3,3-difluoro-2-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156749688 |
| Molecular Formula | C18H27F2NO2 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | tert-butyl 3,3-difluoro-2-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine-1-carboxylate |
| SMILES | C=C/C=C(\C=C/C)CC1N(C(=O)OC(C)(C)C)CCCC1(F)F |
| InChI | InChI=1S/C18H27F2NO2/c1-6-9-14(10-7-2)13-15-18(19,20)11-8-12-21(15)16(22)23-17(3,4)5/h6-7,9-10,15H,1,8,11-13H2,2-5H3/b10-7-,14-9+ |
| InChIKey | GZLITZHEUDAVBU-WUQVPHFESA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|