C14H16N4O3S2 — CID 156749790
N-[2,3-bis(ethenyl)-4-hydroxy-5-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]ethanesulfonamide (PubChem CID 156749790) has the molecular formula C14H16N4O3S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[2,3-bis(ethenyl)-4-hydroxy-5-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]ethanesulfonamide.
| Compound Name | N-[2,3-bis(ethenyl)-4-hydroxy-5-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 156749790 |
| Molecular Formula | C14H16N4O3S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | N-[2,3-bis(ethenyl)-4-hydroxy-5-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]ethanesulfonamide |
| SMILES | C=Cc1c(NS(=O)(=O)CC)cc(Sc2ncn[nH]2)c(O)c1C=C |
| InChI | InChI=1S/C14H16N4O3S2/c1-4-9-10(5-2)13(19)12(22-14-15-8-16-17-14)7-11(9)18-23(20,21)6-3/h4-5,7-8,18-19H,1-2,6H2,3H3,(H,15,16,17) |
| InChIKey | KFRWHNZENLNFHG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|