C28H31N3O6S — CID 156749792
ethane;N-[4-hydroxy-3-[6-hydroxy-3-methyl-2-[(Z)-prop-1-enyl]phenyl]naphthalen-1-yl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 156749792) has the molecular formula C28H31N3O6S and a molecular weight of 537.64 g/mol. Its IUPAC name is ethane;N-[4-hydroxy-3-[6-hydroxy-3-methyl-2-[(Z)-prop-1-enyl]phenyl]naphthalen-1-yl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | ethane;N-[4-hydroxy-3-[6-hydroxy-3-methyl-2-[(Z)-prop-1-enyl]phenyl]naphthalen-1-yl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 156749792 |
| Molecular Formula | C28H31N3O6S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | ethane;N-[4-hydroxy-3-[6-hydroxy-3-methyl-2-[(Z)-prop-1-enyl]phenyl]naphthalen-1-yl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | C/C=C\c1c(C)ccc(O)c1-c1cc(NS(=O)(=O)c2cn(C)c(=O)n(C)c2=O)c2ccccc2c1O.CC |
| InChI | InChI=1S/C26H25N3O6S.C2H6/c1-5-8-16-15(2)11-12-21(30)23(16)19-13-20(17-9-6-7-10-18(17)24(19)31)27-36(34,35)22-14-28(3)26(33)29(4)25(22)32;1-2/h5-14,27,30-31H,1-4H3;1-2H3/b8-5-; |
| InChIKey | MVDVUQZOEJQVFK-HGKIGUAWSA-N |
| XLogP | 4.48 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|