About (4,4-difluoropiperidin-3-yl)methanol;ethane
(4,4-difluoropiperidin-3-yl)methanol;ethane (PubChem CID 156750006) has the molecular formula C8H17F2NO
and a molecular weight of 181.23 g/mol. Its IUPAC name is (4,4-difluoropiperidin-3-yl)methanol;ethane.
Molecular Properties
| Compound Name | (4,4-difluoropiperidin-3-yl)methanol;ethane |
| PubChem CID | 156750006 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (4,4-difluoropiperidin-3-yl)methanol;ethane |
| SMILES | CC.OCC1CNCCC1(F)F |
| InChI | InChI=1S/C6H11F2NO.C2H6/c7-6(8)1-2-9-3-5(6)4-10;1-2/h5,9-10H,1-4H2;1-2H3 |
| InChIKey | YKOGASZGFNMHAY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,4-difluoropiperidin-3-yl)methanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluoropiperidin-3-yl)methanol;ethane?
The IUPAC name of (4,4-difluoropiperidin-3-yl)methanol;ethane (CID 156750006) is (4,4-difluoropiperidin-3-yl)methanol;ethane.
What is the SMILES notation for (4,4-difluoropiperidin-3-yl)methanol;ethane?
The canonical SMILES for (4,4-difluoropiperidin-3-yl)methanol;ethane is CC.OCC1CNCCC1(F)F.
What is the InChIKey of (4,4-difluoropiperidin-3-yl)methanol;ethane?
The InChIKey is YKOGASZGFNMHAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2NO.C2H6/c7-6(8)1-2-9-3-5(6)4-10;1-2/h5,9-10H,1-4H2;1-2H3.
What are the key properties of (4,4-difluoropiperidin-3-yl)methanol;ethane?
(4,4-difluoropiperidin-3-yl)methanol;ethane has a molecular weight of 181.23 g/mol, XLogP of 1.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluoropiperidin-3-yl)methanol;ethane is sourced from PubChem (CID 156750006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).