About 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane
4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane (PubChem CID 156750267) has the molecular formula C13H16F2O2
and a molecular weight of 242.26 g/mol. Its IUPAC name is 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane.
Molecular Properties
| Compound Name | 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane |
| PubChem CID | 156750267 |
| Molecular Formula | C13H16F2O2 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane |
| SMILES | COc1c(C2COC(C)C2C)ccc(F)c1F |
| InChI | InChI=1S/C13H16F2O2/c1-7-8(2)17-6-10(7)9-4-5-11(14)12(15)13(9)16-3/h4-5,7-8,10H,6H2,1-3H3 |
| InChIKey | HOFZXDSKBQSDQS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane?
The IUPAC name of 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane (CID 156750267) is 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane.
What is the SMILES notation for 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane?
The canonical SMILES for 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane is COc1c(C2COC(C)C2C)ccc(F)c1F.
What is the InChIKey of 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane?
The InChIKey is HOFZXDSKBQSDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2O2/c1-7-8(2)17-6-10(7)9-4-5-11(14)12(15)13(9)16-3/h4-5,7-8,10H,6H2,1-3H3.
What are the key properties of 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane?
4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane has a molecular weight of 242.26 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluoro-2-methoxyphenyl)-2,3-dimethyloxolane is sourced from PubChem (CID 156750267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).