C18H21N3O4 — CID 156750867
2-[6-[(E)-4-hydroxybut-1-enyl]-2-oxo-3-(2-phenylethylamino)pyrazin-1-yl]acetic acid (PubChem CID 156750867) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[6-[(E)-4-hydroxybut-1-enyl]-2-oxo-3-(2-phenylethylamino)pyrazin-1-yl]acetic acid.
| Compound Name | 2-[6-[(E)-4-hydroxybut-1-enyl]-2-oxo-3-(2-phenylethylamino)pyrazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 156750867 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[6-[(E)-4-hydroxybut-1-enyl]-2-oxo-3-(2-phenylethylamino)pyrazin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(/C=C/CCO)cnc(NCCc2ccccc2)c1=O |
| InChI | InChI=1S/C18H21N3O4/c22-11-5-4-8-15-12-20-17(18(25)21(15)13-16(23)24)19-10-9-14-6-2-1-3-7-14/h1-4,6-8,12,22H,5,9-11,13H2,(H,19,20)(H,23,24)/b8-4+ |
| InChIKey | PDSJSZZPXANLNC-XBXARRHUSA-N |
| XLogP | 1.38 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |