About ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate
ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate (PubChem CID 156750958) has the molecular formula C21H28N2O2
and a molecular weight of 340.47 g/mol. Its IUPAC name is ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate.
Molecular Properties
| Compound Name | ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate |
| PubChem CID | 156750958 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate |
| SMILES | CC.[H]/N=C(/NC(=O)OCc1ccc(C(C)C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22N2O2.C2H6/c1-13(2)16-10-6-15(7-11-16)12-23-19(22)21-18(20)17-8-4-14(3)5-9-17;1-2/h4-11,13H,12H2,1-3H3,(H2,20,21,22);1-2H3 |
| InChIKey | IKMOJSNZXMYUMN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate?
The IUPAC name of ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate (CID 156750958) is ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate.
What is the SMILES notation for ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate?
The canonical SMILES for ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate is CC.[H]/N=C(/NC(=O)OCc1ccc(C(C)C)cc1)c1ccc(C)cc1.
What is the InChIKey of ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate?
The InChIKey is IKMOJSNZXMYUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2.C2H6/c1-13(2)16-10-6-15(7-11-16)12-23-19(22)21-18(20)17-8-4-14(3)5-9-17;1-2/h4-11,13H,12H2,1-3H3,(H2,20,21,22);1-2H3.
What are the key properties of ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate?
ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate has a molecular weight of 340.47 g/mol, XLogP of 5.40, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-propan-2-ylphenyl)methyl N-(4-methylbenzenecarboximidoyl)carbamate is sourced from PubChem (CID 156750958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).