C13H22N2S — CID 156750979
1,2-dimethyl-5H-pyrrolo[3,2-c]pyridine-6-thione;ethane (PubChem CID 156750979) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 1,2-dimethyl-5H-pyrrolo[3,2-c]pyridine-6-thione;ethane.
| Compound Name | 1,2-dimethyl-5H-pyrrolo[3,2-c]pyridine-6-thione;ethane |
|---|---|
| PubChem CID | 156750979 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1,2-dimethyl-5H-pyrrolo[3,2-c]pyridine-6-thione;ethane |
| SMILES | CC.CC.Cc1cc2c[nH]c(=S)cc2n1C |
| InChI | InChI=1S/C9H10N2S.2C2H6/c1-6-3-7-5-10-9(12)4-8(7)11(6)2;2*1-2/h3-5H,1-2H3,(H,10,12);2*1-2H3 |
| InChIKey | MOMXKMXPASWPLI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|