C23H26Cl2N2O2 — CID 156751163
(5E)-1-[(2S,4Z)-2-amino-4-ethenylhepta-4,6-dienoyl]-5-[(3,4-dichlorophenyl)methylidene]-3,3-dimethylpiperidin-4-one (PubChem CID 156751163) has the molecular formula C23H26Cl2N2O2 and a molecular weight of 433.38 g/mol. Its IUPAC name is (5E)-1-[(2S,4Z)-2-amino-4-ethenylhepta-4,6-dienoyl]-5-[(3,4-dichlorophenyl)methylidene]-3,3-dimethylpiperidin-4-one.
| Compound Name | (5E)-1-[(2S,4Z)-2-amino-4-ethenylhepta-4,6-dienoyl]-5-[(3,4-dichlorophenyl)methylidene]-3,3-dimethylpiperidin-4-one |
|---|---|
| PubChem CID | 156751163 |
| Molecular Formula | C23H26Cl2N2O2 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (5E)-1-[(2S,4Z)-2-amino-4-ethenylhepta-4,6-dienoyl]-5-[(3,4-dichlorophenyl)methylidene]-3,3-dimethylpiperidin-4-one |
| SMILES | C=C/C=C(\C=C)C[C@H](N)C(=O)N1C/C(=C\c2ccc(Cl)c(Cl)c2)C(=O)C(C)(C)C1 |
| InChI | InChI=1S/C23H26Cl2N2O2/c1-5-7-15(6-2)12-20(26)22(29)27-13-17(21(28)23(3,4)14-27)10-16-8-9-18(24)19(25)11-16/h5-11,20H,1-2,12-14,26H2,3-4H3/b15-7+,17-10+/t20-/m0/s1 |
| InChIKey | UXUUPZUYBICZAP-WCLWSUBMSA-N |
| XLogP | 4.83 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|