C24H48O6P2 — CID 156751855
1,10-bis[[ethenyl(pentoxy)phosphoryl]oxy]decane (PubChem CID 156751855) has the molecular formula C24H48O6P2 and a molecular weight of 494.59 g/mol. Its IUPAC name is 1,10-bis[[ethenyl(pentoxy)phosphoryl]oxy]decane.
| Compound Name | 1,10-bis[[ethenyl(pentoxy)phosphoryl]oxy]decane |
|---|---|
| PubChem CID | 156751855 |
| Molecular Formula | C24H48O6P2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 1,10-bis[[ethenyl(pentoxy)phosphoryl]oxy]decane |
| SMILES | C=CP(=O)(OCCCCC)OCCCCCCCCCCOP(=O)(C=C)OCCCCC |
| InChI | InChI=1S/C24H48O6P2/c1-5-9-17-21-27-31(25,7-3)29-23-19-15-13-11-12-14-16-20-24-30-32(26,8-4)28-22-18-10-6-2/h7-8H,3-6,9-24H2,1-2H3 |
| InChIKey | SIOVJFWXXKTZDO-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|