C30H34FN5O3 — CID 156752682
1-cyclopropyl-6-fluoro-7-[2-[[4-(methylamino)phenyl]methoxyamino]ethoxy]-3-[[(2-methyl-4-pyridinyl)methylamino]methyl]quinolin-4-one (PubChem CID 156752682) has the molecular formula C30H34FN5O3 and a molecular weight of 531.63 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[2-[[4-(methylamino)phenyl]methoxyamino]ethoxy]-3-[[(2-methyl-4-pyridinyl)methylamino]methyl]quinolin-4-one.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[2-[[4-(methylamino)phenyl]methoxyamino]ethoxy]-3-[[(2-methyl-4-pyridinyl)methylamino]methyl]quinolin-4-one |
|---|---|
| PubChem CID | 156752682 |
| Molecular Formula | C30H34FN5O3 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[2-[[4-(methylamino)phenyl]methoxyamino]ethoxy]-3-[[(2-methyl-4-pyridinyl)methylamino]methyl]quinolin-4-one |
| SMILES | CNc1ccc(CONCCOc2cc3c(cc2F)c(=O)c(CNCc2ccnc(C)c2)cn3C2CC2)cc1 |
| InChI | InChI=1S/C30H34FN5O3/c1-20-13-22(9-10-34-20)16-33-17-23-18-36(25-7-8-25)28-15-29(27(31)14-26(28)30(23)37)38-12-11-35-39-19-21-3-5-24(32-2)6-4-21/h3-6,9-10,13-15,18,25,32-33,35H,7-8,11-12,16-17,19H2,1-2H3 |
| InChIKey | HFGFMQGSCGLTIF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|