About [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane
[(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane (PubChem CID 156753901) has the molecular formula C10H15F
and a molecular weight of 154.23 g/mol. Its IUPAC name is [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane.
Molecular Properties
| Compound Name | [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane |
| PubChem CID | 156753901 |
| Molecular Formula | C10H15F |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane |
| SMILES | C=C(F)C/C(C)=C/CC1CC1 |
| InChI | InChI=1S/C10H15F/c1-8(7-9(2)11)3-4-10-5-6-10/h3,10H,2,4-7H2,1H3/b8-3+ |
| InChIKey | YPXVEVBFQLOCIX-FPYGCLRLSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane?
The IUPAC name of [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane (CID 156753901) is [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane.
What is the SMILES notation for [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane?
The canonical SMILES for [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane is C=C(F)C/C(C)=C/CC1CC1.
What is the InChIKey of [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane?
The InChIKey is YPXVEVBFQLOCIX-FPYGCLRLSA-N. The full InChI is InChI=1S/C10H15F/c1-8(7-9(2)11)3-4-10-5-6-10/h3,10H,2,4-7H2,1H3/b8-3+.
What are the key properties of [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane?
[(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane has a molecular weight of 154.23 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-5-fluoro-3-methylhexa-2,5-dienyl]cyclopropane is sourced from PubChem (CID 156753901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).