C13H25NO — CID 156753921
(3aR,6aS)-2-[2-(methoxymethyl)butyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 156753921) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (3aR,6aS)-2-[2-(methoxymethyl)butyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-2-[2-(methoxymethyl)butyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 156753921 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (3aR,6aS)-2-[2-(methoxymethyl)butyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CCC(COC)CN1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C13H25NO/c1-3-11(10-15-2)7-14-8-12-5-4-6-13(12)9-14/h11-13H,3-10H2,1-2H3/t11?,12-,13+ |
| InChIKey | BRUMKCUWBUMZQE-YHWZYXNKSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |