About 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene
7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene (PubChem CID 156754029) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene |
| PubChem CID | 156754029 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene |
| SMILES | C#Cc1ccc2c(c1)CCC(C)(C)C2 |
| InChI | InChI=1S/C14H16/c1-4-11-5-6-13-10-14(2,3)8-7-12(13)9-11/h1,5-6,9H,7-8,10H2,2-3H3 |
| InChIKey | KOICNXATXSINEH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene?
The IUPAC name of 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene (CID 156754029) is 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene.
What is the SMILES notation for 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene?
The canonical SMILES for 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene is C#Cc1ccc2c(c1)CCC(C)(C)C2.
What is the InChIKey of 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene?
The InChIKey is KOICNXATXSINEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16/c1-4-11-5-6-13-10-14(2,3)8-7-12(13)9-11/h1,5-6,9H,7-8,10H2,2-3H3.
What are the key properties of 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene?
7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene has a molecular weight of 184.28 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethynyl-3,3-dimethyl-2,4-dihydro-1H-naphthalene is sourced from PubChem (CID 156754029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).