C15H18O3S — CID 156754651
10-tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trienyl methanesulfonate (PubChem CID 156754651) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is 10-tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trienyl methanesulfonate.
| Compound Name | 10-tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trienyl methanesulfonate |
|---|---|
| PubChem CID | 156754651 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 10-tetracyclo[8.2.1.18,11.02,7]tetradeca-2,4,6-trienyl methanesulfonate |
| SMILES | CS(=O)(=O)OC12CC3CC1CC(C2)c1ccccc13 |
| InChI | InChI=1S/C15H18O3S/c1-19(16,17)18-15-8-10-6-12(15)7-11(9-15)14-5-3-2-4-13(10)14/h2-5,10-12H,6-9H2,1H3 |
| InChIKey | JJIPTWYQDILCDS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|