C33H47N5O4S — CID 156754802
(5S)-5-[[[benzyl(ethyl)amino]-(2,2-diethoxyethylamino)methylidene]amino]-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 156754802) has the molecular formula C33H47N5O4S and a molecular weight of 609.84 g/mol. Its IUPAC name is (5S)-5-[[[benzyl(ethyl)amino]-(2,2-diethoxyethylamino)methylidene]amino]-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (5S)-5-[[[benzyl(ethyl)amino]-(2,2-diethoxyethylamino)methylidene]amino]-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 156754802 |
| Molecular Formula | C33H47N5O4S |
| Molecular Weight | 609.84 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | (5S)-5-[[[benzyl(ethyl)amino]-(2,2-diethoxyethylamino)methylidene]amino]-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCOC(CN/C(=N\[C@H]1CCc2sc(NC(=O)C3CC3)c(C(=O)NCC3CC3)c2C1)N(CC)Cc1ccccc1)OCC |
| InChI | InChI=1S/C33H47N5O4S/c1-4-38(21-23-10-8-7-9-11-23)33(35-20-28(41-5-2)42-6-3)36-25-16-17-27-26(18-25)29(31(40)34-19-22-12-13-22)32(43-27)37-30(39)24-14-15-24/h7-11,22,24-25,28H,4-6,12-21H2,1-3H3,(H,34,40)(H,35,36)(H,37,39)/t25-/m0/s1 |
| InChIKey | DQSDILNZLHWBSW-VWLOTQADSA-N |
| XLogP | 4.96 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|