About 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane
1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane (PubChem CID 156754947) has the molecular formula C17H20F2N4O
and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane |
| PubChem CID | 156754947 |
| Molecular Formula | C17H20F2N4O |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane |
| SMILES | C[C@@H](Oc1nc(N2CCCNCC2)ncc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20F2N4O/c1-12(13-3-5-14(18)6-4-13)24-16-15(19)11-21-17(22-16)23-9-2-7-20-8-10-23/h3-6,11-12,20H,2,7-10H2,1H3/t12-/m1/s1 |
| InChIKey | GJFUUWPODFDBDP-GFCCVEGCSA-N |
| XLogP | 2.69 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane?
The IUPAC name of 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane (CID 156754947) is 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane.
What is the SMILES notation for 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane?
The canonical SMILES for 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane is C[C@@H](Oc1nc(N2CCCNCC2)ncc1F)c1ccc(F)cc1.
What is the InChIKey of 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane?
The InChIKey is GJFUUWPODFDBDP-GFCCVEGCSA-N. The full InChI is InChI=1S/C17H20F2N4O/c1-12(13-3-5-14(18)6-4-13)24-16-15(19)11-21-17(22-16)23-9-2-7-20-8-10-23/h3-6,11-12,20H,2,7-10H2,1H3/t12-/m1/s1.
What are the key properties of 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane?
1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane has a molecular weight of 334.37 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-fluoro-4-[(1R)-1-(4-fluorophenyl)ethoxy]pyrimidin-2-yl]-1,4-diazepane is sourced from PubChem (CID 156754947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).