C36H52N6O12 — CID 156755165
tert-butyl 4-[[(2S,3R)-2,3-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate (PubChem CID 156755165) has the molecular formula C36H52N6O12 and a molecular weight of 760.84 g/mol. Its IUPAC name is tert-butyl 4-[[(2S,3R)-2,3-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate.
| Compound Name | tert-butyl 4-[[(2S,3R)-2,3-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate |
|---|---|
| PubChem CID | 156755165 |
| Molecular Formula | C36H52N6O12 |
| Molecular Weight | 760.84 g/mol |
| Exact Mass | 760.36 |
| IUPAC Name | tert-butyl 4-[[(2S,3R)-2,3-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNC(=O)[C@@H](NC(=O)CCCN1C(=O)C=CC1=O)[C@@H](NC(=O)CCCN1C(=O)C=CC1=O)C(=O)NCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H52N6O12/c1-35(2,3)53-29(49)13-7-19-37-33(51)31(39-23(43)11-9-21-41-25(45)15-16-26(41)46)32(34(52)38-20-8-14-30(50)54-36(4,5)6)40-24(44)12-10-22-42-27(47)17-18-28(42)48/h15-18,31-32H,7-14,19-22H2,1-6H3,(H,37,51)(H,38,52)(H,39,43)(H,40,44)/t31-,32+ |
| InChIKey | JXNZZXVUTMLACP-MEKGRNQZSA-N |
| XLogP | -0.16 |
| TPSA | 243.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.84 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|