C40H41FN6O3S — CID 156755515
1-[S-[(6S)-6-(dimethylamino)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]-N-tritylsulfonimidoyl]-3-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 156755515) has the molecular formula C40H41FN6O3S and a molecular weight of 704.87 g/mol. Its IUPAC name is 1-[S-[(6S)-6-(dimethylamino)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]-N-tritylsulfonimidoyl]-3-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[S-[(6S)-6-(dimethylamino)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]-N-tritylsulfonimidoyl]-3-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 156755515 |
| Molecular Formula | C40H41FN6O3S |
| Molecular Weight | 704.87 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | 1-[S-[(6S)-6-(dimethylamino)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]-N-tritylsulfonimidoyl]-3-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CN(C)[C@@H]1COc2c(S(=O)(=NC(c3ccccc3)(c3ccccc3)c3ccccc3)NC(=O)Nc3c4c(c(F)c5c3CCC5)CCC4)cnn2C1 |
| InChI | InChI=1S/C40H41FN6O3S/c1-46(2)30-25-47-38(50-26-30)35(24-42-47)51(49,44-39(48)43-37-33-22-12-20-31(33)36(41)32-21-13-23-34(32)37)45-40(27-14-6-3-7-15-27,28-16-8-4-9-17-28)29-18-10-5-11-19-29/h3-11,14-19,24,30H,12-13,20-23,25-26H2,1-2H3,(H2,43,44,45,48,49)/t30-,51?/m0/s1 |
| InChIKey | DDZKHMPYTXLZMZ-HDYGDMNUSA-N |
| XLogP | 6.88 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.87 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|