C21H51N3Si2 — CID 156755975
N,N-bis[(dipropylamino)-dimethylsilyl]pentan-1-amine (PubChem CID 156755975) has the molecular formula C21H51N3Si2 and a molecular weight of 401.83 g/mol. Its IUPAC name is N,N-bis[(dipropylamino)-dimethylsilyl]pentan-1-amine.
| Compound Name | N,N-bis[(dipropylamino)-dimethylsilyl]pentan-1-amine |
|---|---|
| PubChem CID | 156755975 |
| Molecular Formula | C21H51N3Si2 |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.36 |
| IUPAC Name | N,N-bis[(dipropylamino)-dimethylsilyl]pentan-1-amine |
| SMILES | CCCCCN([Si](C)(C)N(CCC)CCC)[Si](C)(C)N(CCC)CCC |
| InChI | InChI=1S/C21H51N3Si2/c1-10-15-16-21-24(25(6,7)22(17-11-2)18-12-3)26(8,9)23(19-13-4)20-14-5/h10-21H2,1-9H3 |
| InChIKey | XVGHOLUOAWCBOX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|