C21H51N3Si2 — CID 156756023
N,N-bis[tert-butyl-(ethylamino)-propan-2-ylsilyl]propan-1-amine (PubChem CID 156756023) has the molecular formula C21H51N3Si2 and a molecular weight of 401.83 g/mol. Its IUPAC name is N,N-bis[tert-butyl-(ethylamino)-propan-2-ylsilyl]propan-1-amine.
| Compound Name | N,N-bis[tert-butyl-(ethylamino)-propan-2-ylsilyl]propan-1-amine |
|---|---|
| PubChem CID | 156756023 |
| Molecular Formula | C21H51N3Si2 |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.36 |
| IUPAC Name | N,N-bis[tert-butyl-(ethylamino)-propan-2-ylsilyl]propan-1-amine |
| SMILES | CCCN([Si](NCC)(C(C)C)C(C)(C)C)[Si](NCC)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H51N3Si2/c1-14-17-24(25(18(4)5,22-15-2)20(8,9)10)26(19(6)7,23-16-3)21(11,12)13/h18-19,22-23H,14-17H2,1-13H3 |
| InChIKey | XDYRKXQVFCSNHE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|