C36H9N15 — CID 156756799
4,9,14-tris(3,4-dicyanophenyl)-3,5,8,10,13,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene-3,8,13-tricarbonitrile (PubChem CID 156756799) has the molecular formula C36H9N15 and a molecular weight of 651.57 g/mol. Its IUPAC name is 4,9,14-tris(3,4-dicyanophenyl)-3,5,8,10,13,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene-3,8,13-tricarbonitrile.
| Compound Name | 4,9,14-tris(3,4-dicyanophenyl)-3,5,8,10,13,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene-3,8,13-tricarbonitrile |
|---|---|
| PubChem CID | 156756799 |
| Molecular Formula | C36H9N15 |
| Molecular Weight | 651.57 g/mol |
| Exact Mass | 651.12 |
| IUPAC Name | 4,9,14-tris(3,4-dicyanophenyl)-3,5,8,10,13,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene-3,8,13-tricarbonitrile |
| SMILES | N#Cc1ccc(-c2nc3c(c4nc(-c5ccc(C#N)c(C#N)c5)n(C#N)c4c4nc(-c5ccc(C#N)c(C#N)c5)n(C#N)c34)n2C#N)cc1C#N |
| InChI | InChI=1S/C36H9N15/c37-10-22-4-1-19(7-25(22)13-40)34-46-28-31(49(34)16-43)29-33(51(18-45)35(47-29)20-2-5-23(11-38)26(8-20)14-41)30-32(28)50(17-44)36(48-30)21-3-6-24(12-39)27(9-21)15-42/h1-9H |
| InChIKey | AOJHGWQCPDSLPQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 267.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |