C63H42N6 — CID 156756821
3,8,13-triphenyl-4,9,14-tris(4-pyridin-3-ylphenyl)-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene (PubChem CID 156756821) has the molecular formula C63H42N6 and a molecular weight of 883.07 g/mol. Its IUPAC name is 3,8,13-triphenyl-4,9,14-tris(4-pyridin-3-ylphenyl)-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene.
| Compound Name | 3,8,13-triphenyl-4,9,14-tris(4-pyridin-3-ylphenyl)-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
|---|---|
| PubChem CID | 156756821 |
| Molecular Formula | C63H42N6 |
| Molecular Weight | 883.07 g/mol |
| Exact Mass | 882.35 |
| IUPAC Name | 3,8,13-triphenyl-4,9,14-tris(4-pyridin-3-ylphenyl)-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
| SMILES | c1ccc(-n2c(-c3ccc(-c4cccnc4)cc3)cc3c2c2cc(-c4ccc(-c5cccnc5)cc4)n(-c4ccccc4)c2c2cc(-c4ccc(-c5cccnc5)cc4)n(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C63H42N6/c1-4-16-52(17-5-1)67-58(46-28-22-43(23-29-46)49-13-10-34-64-40-49)37-55-61(67)56-38-59(47-30-24-44(25-31-47)50-14-11-35-65-41-50)68(53-18-6-2-7-19-53)63(56)57-39-60(69(62(55)57)54-20-8-3-9-21-54)48-32-26-45(27-33-48)51-15-12-36-66-42-51/h1-42H |
| InChIKey | WNEXJNJUWSZGFV-UHFFFAOYSA-N |
| XLogP | 15.71 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.07 |
| LogP ≤ 5 | 15.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |