C45H24F3N3 — CID 156756894
3-[4-[2-[2,4,6-trifluoro-3,5-bis[2-(4-pyridin-3-ylphenyl)ethynyl]phenyl]ethynyl]phenyl]pyridine (PubChem CID 156756894) has the molecular formula C45H24F3N3 and a molecular weight of 663.70 g/mol. Its IUPAC name is 3-[4-[2-[2,4,6-trifluoro-3,5-bis[2-(4-pyridin-3-ylphenyl)ethynyl]phenyl]ethynyl]phenyl]pyridine.
| Compound Name | 3-[4-[2-[2,4,6-trifluoro-3,5-bis[2-(4-pyridin-3-ylphenyl)ethynyl]phenyl]ethynyl]phenyl]pyridine |
|---|---|
| PubChem CID | 156756894 |
| Molecular Formula | C45H24F3N3 |
| Molecular Weight | 663.70 g/mol |
| Exact Mass | 663.19 |
| IUPAC Name | 3-[4-[2-[2,4,6-trifluoro-3,5-bis[2-(4-pyridin-3-ylphenyl)ethynyl]phenyl]ethynyl]phenyl]pyridine |
| SMILES | Fc1c(C#Cc2ccc(-c3cccnc3)cc2)c(F)c(C#Cc2ccc(-c3cccnc3)cc2)c(F)c1C#Cc1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C45H24F3N3/c46-43-40(22-13-31-7-16-34(17-8-31)37-4-1-25-49-28-37)44(47)42(24-15-33-11-20-36(21-12-33)39-6-3-27-51-30-39)45(48)41(43)23-14-32-9-18-35(19-10-32)38-5-2-26-50-29-38/h1-12,16-21,25-30H |
| InChIKey | HJBJYFPTMYDBTO-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.70 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|