C21H27BN2O2 — CID 156757144
3-ethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3a-dihydrobenzimidazole (PubChem CID 156757144) has the molecular formula C21H27BN2O2 and a molecular weight of 350.27 g/mol. Its IUPAC name is 3-ethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3a-dihydrobenzimidazole.
| Compound Name | 3-ethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3a-dihydrobenzimidazole |
|---|---|
| PubChem CID | 156757144 |
| Molecular Formula | C21H27BN2O2 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 3-ethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,3a-dihydrobenzimidazole |
| SMILES | CCN1C2C=CC=CC2=NC1c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H27BN2O2/c1-6-24-18-10-8-7-9-17(18)23-19(24)15-11-13-16(14-12-15)22-25-20(2,3)21(4,5)26-22/h7-14,18-19H,6H2,1-5H3 |
| InChIKey | ONNXMCROUHYTDI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|