C22H28O9 — CID 156757406
[(2S)-1-oxo-1-phenylmethoxypropan-2-yl] (2S,4S,6S)-6-[(2S)-2-hydroxypropanoyl]oxy-2,4-dimethyl-3,5-dioxoheptanoate (PubChem CID 156757406) has the molecular formula C22H28O9 and a molecular weight of 436.46 g/mol. Its IUPAC name is [(2S)-1-oxo-1-phenylmethoxypropan-2-yl] (2S,4S,6S)-6-[(2S)-2-hydroxypropanoyl]oxy-2,4-dimethyl-3,5-dioxoheptanoate.
| Compound Name | [(2S)-1-oxo-1-phenylmethoxypropan-2-yl] (2S,4S,6S)-6-[(2S)-2-hydroxypropanoyl]oxy-2,4-dimethyl-3,5-dioxoheptanoate |
|---|---|
| PubChem CID | 156757406 |
| Molecular Formula | C22H28O9 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [(2S)-1-oxo-1-phenylmethoxypropan-2-yl] (2S,4S,6S)-6-[(2S)-2-hydroxypropanoyl]oxy-2,4-dimethyl-3,5-dioxoheptanoate |
| SMILES | C[C@H](C(=O)O[C@@H](C)C(=O)OCc1ccccc1)C(=O)[C@H](C)C(=O)[C@H](C)OC(=O)[C@H](C)O |
| InChI | InChI=1S/C22H28O9/c1-12(19(25)15(4)30-21(27)14(3)23)18(24)13(2)20(26)31-16(5)22(28)29-11-17-9-7-6-8-10-17/h6-10,12-16,23H,11H2,1-5H3/t12-,13-,14-,15-,16-/m0/s1 |
| InChIKey | ZLJGUFRASPZTKE-QXKUPLGCSA-N |
| XLogP | 1.38 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|