C21H35NO5 — CID 156757449
butyl N-[5-[2-(2-phenylmethoxyethoxy)ethoxy]pentyl]carbamate (PubChem CID 156757449) has the molecular formula C21H35NO5 and a molecular weight of 381.51 g/mol. Its IUPAC name is butyl N-[5-[2-(2-phenylmethoxyethoxy)ethoxy]pentyl]carbamate.
| Compound Name | butyl N-[5-[2-(2-phenylmethoxyethoxy)ethoxy]pentyl]carbamate |
|---|---|
| PubChem CID | 156757449 |
| Molecular Formula | C21H35NO5 |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | butyl N-[5-[2-(2-phenylmethoxyethoxy)ethoxy]pentyl]carbamate |
| SMILES | CCCCOC(=O)NCCCCCOCCOCCOCc1ccccc1 |
| InChI | InChI=1S/C21H35NO5/c1-2-3-14-27-21(23)22-12-8-5-9-13-24-15-16-25-17-18-26-19-20-10-6-4-7-11-20/h4,6-7,10-11H,2-3,5,8-9,12-19H2,1H3,(H,22,23) |
| InChIKey | XVPMLWOXYGTDQA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|