About 2-(triazol-2-yl)phenol;hydrochloride
2-(triazol-2-yl)phenol;hydrochloride (PubChem CID 156757667) has the molecular formula C8H8ClN3O
and a molecular weight of 197.63 g/mol. Its IUPAC name is 2-(triazol-2-yl)phenol;hydrochloride.
Molecular Properties
| Compound Name | 2-(triazol-2-yl)phenol;hydrochloride |
| PubChem CID | 156757667 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.63 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-(triazol-2-yl)phenol;hydrochloride |
| SMILES | Cl.Oc1ccccc1-n1nccn1 |
| InChI | InChI=1S/C8H7N3O.ClH/c12-8-4-2-1-3-7(8)11-9-5-6-10-11;/h1-6,12H;1H |
| InChIKey | KKJWMDKTBPDJEG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.63 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(triazol-2-yl)phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triazol-2-yl)phenol;hydrochloride?
The IUPAC name of 2-(triazol-2-yl)phenol;hydrochloride (CID 156757667) is 2-(triazol-2-yl)phenol;hydrochloride.
What is the SMILES notation for 2-(triazol-2-yl)phenol;hydrochloride?
The canonical SMILES for 2-(triazol-2-yl)phenol;hydrochloride is Cl.Oc1ccccc1-n1nccn1.
What is the InChIKey of 2-(triazol-2-yl)phenol;hydrochloride?
The InChIKey is KKJWMDKTBPDJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O.ClH/c12-8-4-2-1-3-7(8)11-9-5-6-10-11;/h1-6,12H;1H.
What are the key properties of 2-(triazol-2-yl)phenol;hydrochloride?
2-(triazol-2-yl)phenol;hydrochloride has a molecular weight of 197.63 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazol-2-yl)phenol;hydrochloride is sourced from PubChem (CID 156757667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).