About 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate
3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate (PubChem CID 156757723) has the molecular formula C14H20FNO2
and a molecular weight of 253.32 g/mol. Its IUPAC name is 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate |
| PubChem CID | 156757723 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FNO2/c1-10(2)13(16)14(17)18-9-3-4-11-5-7-12(15)8-6-11/h5-8,10,13H,3-4,9,16H2,1-2H3/t13-/m0/s1 |
| InChIKey | FAZMMXYLWYRINH-ZDUSSCGKSA-N |
| XLogP | 2.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate?
The IUPAC name of 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate (CID 156757723) is 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate.
What is the SMILES notation for 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate?
The canonical SMILES for 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate is CC(C)[C@H](N)C(=O)OCCCc1ccc(F)cc1.
What is the InChIKey of 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate?
The InChIKey is FAZMMXYLWYRINH-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H20FNO2/c1-10(2)13(16)14(17)18-9-3-4-11-5-7-12(15)8-6-11/h5-8,10,13H,3-4,9,16H2,1-2H3/t13-/m0/s1.
What are the key properties of 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate?
3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate has a molecular weight of 253.32 g/mol, XLogP of 2.28, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)propyl (2S)-2-amino-3-methylbutanoate is sourced from PubChem (CID 156757723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).