C8H13LiNO4 — CID 156758166
(2S)-1-tert-butoxycarbonylaziridine-2-carboxylic acid;lithium salt (PubChem CID 156758166) has the molecular formula C8H13LiNO4 and a molecular weight of 194.14 g/mol.
| Compound Name | (2S)-1-tert-butoxycarbonylaziridine-2-carboxylic acid;lithium salt |
|---|---|
| PubChem CID | 156758166 |
| Molecular Formula | C8H13LiNO4 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CC1C(=O)O.[Li] |
| InChI | InChI=1S/C8H13NO4.Li/c1-8(2,3)13-7(12)9-4-5(9)6(10)11;/h5H,4H2,1-3H3,(H,10,11); |
| InChIKey | FPGLVOGUMOOCSO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|