C27H46N8O3 — CID 156758579
3-[N'-[8-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)octyl]carbamimidoyl]-1,1-dimethylurea (PubChem CID 156758579) has the molecular formula C27H46N8O3 and a molecular weight of 530.72 g/mol. Its IUPAC name is 3-[N'-[8-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)octyl]carbamimidoyl]-1,1-dimethylurea.
| Compound Name | 3-[N'-[8-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)octyl]carbamimidoyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 156758579 |
| Molecular Formula | C27H46N8O3 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.37 |
| IUPAC Name | 3-[N'-[8-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)octyl]carbamimidoyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N/C(N)=N/CCCCCCCCN1CCCCCCOc2ccccc2C/N=C(/N)NC1=O |
| InChI | InChI=1S/C27H46N8O3/c1-34(2)26(36)32-24(28)30-17-11-5-3-4-6-12-18-35-19-13-7-8-14-20-38-23-16-10-9-15-22(23)21-31-25(29)33-27(35)37/h9-10,15-16H,3-8,11-14,17-21H2,1-2H3,(H3,28,30,32,36)(H3,29,31,33,37) |
| InChIKey | HOHBMPKEFFDCAT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 150.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|