C22H36N8O3 — CID 156758590
1-[N'-[4-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)butyl]carbamimidoyl]-3-methylurea (PubChem CID 156758590) has the molecular formula C22H36N8O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-[N'-[4-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)butyl]carbamimidoyl]-3-methylurea.
| Compound Name | 1-[N'-[4-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)butyl]carbamimidoyl]-3-methylurea |
|---|---|
| PubChem CID | 156758590 |
| Molecular Formula | C22H36N8O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | 1-[N'-[4-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)butyl]carbamimidoyl]-3-methylurea |
| SMILES | CNC(=O)N/C(N)=N/CCCCN1CCCCCCOc2ccccc2C/N=C(/N)NC1=O |
| InChI | InChI=1S/C22H36N8O3/c1-25-21(31)28-19(23)26-12-6-8-14-30-13-7-2-3-9-15-33-18-11-5-4-10-17(18)16-27-20(24)29-22(30)32/h4-5,10-11H,2-3,6-9,12-16H2,1H3,(H3,24,27,29,32)(H4,23,25,26,28,31) |
| InChIKey | AALRGEOVDQNARX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|