C24H40N8O3 — CID 156758595
1-[N'-[6-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)hexyl]carbamimidoyl]-3-methylurea (PubChem CID 156758595) has the molecular formula C24H40N8O3 and a molecular weight of 488.64 g/mol. Its IUPAC name is 1-[N'-[6-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)hexyl]carbamimidoyl]-3-methylurea.
| Compound Name | 1-[N'-[6-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)hexyl]carbamimidoyl]-3-methylurea |
|---|---|
| PubChem CID | 156758595 |
| Molecular Formula | C24H40N8O3 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | 1-[N'-[6-(12-amino-10-oxo-2-oxa-9,11,13-triazabicyclo[13.4.0]nonadeca-1(19),12,15,17-tetraen-9-yl)hexyl]carbamimidoyl]-3-methylurea |
| SMILES | CNC(=O)N/C(N)=N/CCCCCCN1CCCCCCOc2ccccc2C/N=C(/N)NC1=O |
| InChI | InChI=1S/C24H40N8O3/c1-27-23(33)30-21(25)28-14-8-2-3-9-15-32-16-10-4-5-11-17-35-20-13-7-6-12-19(20)18-29-22(26)31-24(32)34/h6-7,12-13H,2-5,8-11,14-18H2,1H3,(H3,26,29,31,34)(H4,25,27,28,30,33) |
| InChIKey | BKRKIMDTJIQNPO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|