C21H42N8O2 — CID 156758600
1-[N'-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]carbamimidoyl]-3-methylurea (PubChem CID 156758600) has the molecular formula C21H42N8O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 1-[N'-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]carbamimidoyl]-3-methylurea.
| Compound Name | 1-[N'-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]carbamimidoyl]-3-methylurea |
|---|---|
| PubChem CID | 156758600 |
| Molecular Formula | C21H42N8O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.34 |
| IUPAC Name | 1-[N'-[8-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)octyl]carbamimidoyl]-3-methylurea |
| SMILES | CNC(=O)N/C(N)=N/CCCCCCCCN1CCCCCCCC/N=C(/N)NC1=O |
| InChI | InChI=1S/C21H42N8O2/c1-24-20(30)27-18(22)25-14-10-6-2-4-8-12-16-29-17-13-9-5-3-7-11-15-26-19(23)28-21(29)31/h2-17H2,1H3,(H3,23,26,28,31)(H4,22,24,25,27,30) |
| InChIKey | MFPRZYJZMSHFPK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|