C25H35N3O — CID 156758983
2-benzyl-1-[4-(dimethylamino)-4-phenylpiperidin-1-yl]-3-(ethylamino)propan-1-one (PubChem CID 156758983) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is 2-benzyl-1-[4-(dimethylamino)-4-phenylpiperidin-1-yl]-3-(ethylamino)propan-1-one.
| Compound Name | 2-benzyl-1-[4-(dimethylamino)-4-phenylpiperidin-1-yl]-3-(ethylamino)propan-1-one |
|---|---|
| PubChem CID | 156758983 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 2-benzyl-1-[4-(dimethylamino)-4-phenylpiperidin-1-yl]-3-(ethylamino)propan-1-one |
| SMILES | CCNCC(Cc1ccccc1)C(=O)N1CCC(c2ccccc2)(N(C)C)CC1 |
| InChI | InChI=1S/C25H35N3O/c1-4-26-20-22(19-21-11-7-5-8-12-21)24(29)28-17-15-25(16-18-28,27(2)3)23-13-9-6-10-14-23/h5-14,22,26H,4,15-20H2,1-3H3 |
| InChIKey | RXYMWQVMIXFEHY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |