C34H37N7O2 — CID 156759672
N-[5-[5-(1,5-dimethylpyrazol-4-yl)-4-methoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide (PubChem CID 156759672) has the molecular formula C34H37N7O2 and a molecular weight of 575.72 g/mol. Its IUPAC name is N-[5-[5-(1,5-dimethylpyrazol-4-yl)-4-methoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[5-(1,5-dimethylpyrazol-4-yl)-4-methoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156759672 |
| Molecular Formula | C34H37N7O2 |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | N-[5-[5-(1,5-dimethylpyrazol-4-yl)-4-methoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncc(-c4cnn(C)c4C)c(OC)c23)ccc1C |
| InChI | InChI=1S/C34H37N7O2/c1-7-29(42)37-28-18-24(9-8-21(28)2)30-31-33(43-6)27(26-20-36-40(5)22(26)3)19-35-34(31)38-32(30)23-10-12-25(13-11-23)41-16-14-39(4)15-17-41/h7-13,18-20H,1,14-17H2,2-6H3,(H,35,38)(H,37,42) |
| InChIKey | PPRFHKKCXYZSAP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|