C18H22F2O5 — CID 156759788
ditert-butyl 2-(difluoromethyl)-5-formylbenzene-1,4-dicarboxylate (PubChem CID 156759788) has the molecular formula C18H22F2O5 and a molecular weight of 356.37 g/mol. Its IUPAC name is ditert-butyl 2-(difluoromethyl)-5-formylbenzene-1,4-dicarboxylate.
| Compound Name | ditert-butyl 2-(difluoromethyl)-5-formylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 156759788 |
| Molecular Formula | C18H22F2O5 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | ditert-butyl 2-(difluoromethyl)-5-formylbenzene-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(C(F)F)c(C(=O)OC(C)(C)C)cc1C=O |
| InChI | InChI=1S/C18H22F2O5/c1-17(2,3)24-15(22)11-8-12(14(19)20)13(7-10(11)9-21)16(23)25-18(4,5)6/h7-9,14H,1-6H3 |
| InChIKey | MAODINYWOZSKKS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|