C21H32N2O4 — CID 156761076
ethyl 3-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylamino]benzoate (PubChem CID 156761076) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is ethyl 3-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylamino]benzoate.
| Compound Name | ethyl 3-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylamino]benzoate |
|---|---|
| PubChem CID | 156761076 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | ethyl 3-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NCC2CCC(NC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H32N2O4/c1-5-26-19(24)16-7-6-8-18(13-16)22-14-15-9-11-17(12-10-15)23-20(25)27-21(2,3)4/h6-8,13,15,17,22H,5,9-12,14H2,1-4H3,(H,23,25) |
| InChIKey | NJGMBJBXWCAVLH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |