C47H54N12O3 — CID 156761662
bis[4-[(3R)-3-aminopiperidin-1-yl]-2-(1-ethylpyrrolo[3,2-b]pyridin-2-yl)-7-methoxy-1-methylbenzimidazol-5-yl]methanone (PubChem CID 156761662) has the molecular formula C47H54N12O3 and a molecular weight of 835.03 g/mol. Its IUPAC name is bis[4-[(3R)-3-aminopiperidin-1-yl]-2-(1-ethylpyrrolo[3,2-b]pyridin-2-yl)-7-methoxy-1-methylbenzimidazol-5-yl]methanone.
| Compound Name | bis[4-[(3R)-3-aminopiperidin-1-yl]-2-(1-ethylpyrrolo[3,2-b]pyridin-2-yl)-7-methoxy-1-methylbenzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 156761662 |
| Molecular Formula | C47H54N12O3 |
| Molecular Weight | 835.03 g/mol |
| Exact Mass | 834.44 |
| IUPAC Name | bis[4-[(3R)-3-aminopiperidin-1-yl]-2-(1-ethylpyrrolo[3,2-b]pyridin-2-yl)-7-methoxy-1-methylbenzimidazol-5-yl]methanone |
| SMILES | CCn1c(-c2nc3c(N4CCC[C@@H](N)C4)c(C(=O)c4cc(OC)c5c(nc(-c6cc7ncccc7n6CC)n5C)c4N4CCC[C@@H](N)C4)cc(OC)c3n2C)cc2ncccc21 |
| InChI | InChI=1S/C47H54N12O3/c1-7-58-33-15-9-17-50-31(33)23-35(58)46-52-39-41(56-19-11-13-27(48)25-56)29(21-37(61-5)43(39)54(46)3)45(60)30-22-38(62-6)44-40(42(30)57-20-12-14-28(49)26-57)53-47(55(44)4)36-24-32-34(59(36)8-2)16-10-18-51-32/h9-10,15-18,21-24,27-28H,7-8,11-14,19-20,25-26,48-49H2,1-6H3/t27-,28-/m1/s1 |
| InChIKey | CHYWJLKBHORKPC-VSGBNLITSA-N |
| XLogP | 6.64 |
| TPSA | 165.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.03 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|