C13H17NO4 — CID 156761956
1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-4-yl)ethyl prop-2-enoate (PubChem CID 156761956) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-4-yl)ethyl prop-2-enoate.
| Compound Name | 1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-4-yl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 156761956 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-4-yl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)C1CCCC2C(=O)NC(=O)C21 |
| InChI | InChI=1S/C13H17NO4/c1-3-10(15)18-7(2)8-5-4-6-9-11(8)13(17)14-12(9)16/h3,7-9,11H,1,4-6H2,2H3,(H,14,16,17) |
| InChIKey | XYLKVKNOKCCDQM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|