C11H15F5O5 — CID 156761993
1-O-propan-2-yl 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate (PubChem CID 156761993) has the molecular formula C11H15F5O5 and a molecular weight of 322.23 g/mol. Its IUPAC name is 1-O-propan-2-yl 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate.
| Compound Name | 1-O-propan-2-yl 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate |
|---|---|
| PubChem CID | 156761993 |
| Molecular Formula | C11H15F5O5 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 1-O-propan-2-yl 3-O-propyl 2-hydroxy-2-(1,1,2,2,2-pentafluoroethyl)propanedioate |
| SMILES | CCCOC(=O)C(O)(C(=O)OC(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H15F5O5/c1-4-5-20-7(17)9(19,8(18)21-6(2)3)10(12,13)11(14,15)16/h6,19H,4-5H2,1-3H3 |
| InChIKey | HWWJVESOURXDGS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|