C11H19F3O5Si — CID 156762000
3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-trimethylsilyloxypropanoic acid (PubChem CID 156762000) has the molecular formula C11H19F3O5Si and a molecular weight of 316.35 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-trimethylsilyloxypropanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-trimethylsilyloxypropanoic acid |
|---|---|
| PubChem CID | 156762000 |
| Molecular Formula | C11H19F3O5Si |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-trimethylsilyloxypropanoic acid |
| SMILES | CC(C)(C)OC(=O)C(O[Si](C)(C)C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H19F3O5Si/c1-9(2,3)18-8(17)10(7(15)16,11(12,13)14)19-20(4,5)6/h1-6H3,(H,15,16) |
| InChIKey | VYTNRSSNMKNAQJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|