C13H21F5O5Si — CID 156762003
1-O-ethyl 3-O-propyl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate (PubChem CID 156762003) has the molecular formula C13H21F5O5Si and a molecular weight of 380.38 g/mol. Its IUPAC name is 1-O-ethyl 3-O-propyl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate.
| Compound Name | 1-O-ethyl 3-O-propyl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate |
|---|---|
| PubChem CID | 156762003 |
| Molecular Formula | C13H21F5O5Si |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-O-ethyl 3-O-propyl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate |
| SMILES | CCCOC(=O)C(O[Si](C)(C)C)(C(=O)OCC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H21F5O5Si/c1-6-8-22-10(20)11(9(19)21-7-2,23-24(3,4)5)12(14,15)13(16,17)18/h6-8H2,1-5H3 |
| InChIKey | BLKYBEATDVNTAE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|