C15H25F5O5Si — CID 156762004
1-O-butyl 3-O-propan-2-yl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate (PubChem CID 156762004) has the molecular formula C15H25F5O5Si and a molecular weight of 408.44 g/mol. Its IUPAC name is 1-O-butyl 3-O-propan-2-yl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate.
| Compound Name | 1-O-butyl 3-O-propan-2-yl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate |
|---|---|
| PubChem CID | 156762004 |
| Molecular Formula | C15H25F5O5Si |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-O-butyl 3-O-propan-2-yl 2-(1,1,2,2,2-pentafluoroethyl)-2-trimethylsilyloxypropanedioate |
| SMILES | CCCCOC(=O)C(O[Si](C)(C)C)(C(=O)OC(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H25F5O5Si/c1-7-8-9-23-11(21)13(25-26(4,5)6,12(22)24-10(2)3)14(16,17)15(18,19)20/h10H,7-9H2,1-6H3 |
| InChIKey | BTSWLMHOCZRTHH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|